summaryrefslogtreecommitdiff
path: root/bin
diff options
context:
space:
mode:
authorTheSiahxyz <164138827+TheSiahxyz@users.noreply.github.com>2025-01-20 22:52:38 +0900
committerTheSiahxyz <164138827+TheSiahxyz@users.noreply.github.com>2025-01-20 22:52:38 +0900
commitc9e72cfb78f2cc2dd9e3c5f0c49e92255bd2db1a (patch)
treeabc0ac09afbf1b17c5489506a700681936153b5f /bin
init
Diffstat (limited to 'bin')
-rwxr-xr-xbin/mailsync112
-rwxr-xr-xbin/mw422
2 files changed, 534 insertions, 0 deletions
diff --git a/bin/mailsync b/bin/mailsync
new file mode 100755
index 0000000..cbd36ff
--- /dev/null
+++ b/bin/mailsync
@@ -0,0 +1,112 @@
+#!/bin/sh
+
+# - Syncs mail for all accounts, or a single account given as an argument.
+# - Displays a notification showing the number of new mails.
+# - Displays a notification for each new mail with its subject displayed.
+# - Runs notmuch to index new mail.
+# - This script can be set up as a cron job for automated mail syncing.
+
+# There are many arbitrary and ugly features in this script because it is
+# inherently difficult to pass environmental variables to cronjobs and other
+# issues. It also should at least be compatible with Linux (and maybe BSD) with
+# Xorg and MacOS as well.
+
+# Run only if not already running in other instance
+pgrep mbsync >/dev/null && { echo "mbsync is already running."; exit ;}
+
+# First, we have to get the right variables for the mbsync file, the pass
+# archive, notmuch and the GPG home. This is done by searching common profile
+# files for variable assignments. This is ugly, but there are few options that
+# will work on the maximum number of machines.
+eval "$(grep -h -- \
+ "^\s*\(export \)\?\(MBSYNCRC\|MPOPRC\|PASSWORD_STORE_DIR\|PASSWORD_STORE_GPG_OPTS\|NOTMUCH_CONFIG\|GNUPGHOME\|MAILSYNC_MUTE\|XDG_CONFIG_HOME\|XDG_DATA_HOME\)=" \
+ "$HOME/.profile" "$HOME/.bash_profile" "$HOME/.zprofile" "$HOME/.config/zsh/.zprofile" "$HOME/.zshenv" \
+ "$HOME/.config/zsh/.zshenv" "$HOME/.bashrc" "$HOME/.zshrc" "$HOME/.config/zsh/.zshrc" \
+ "$HOME/.pam_environment" 2>/dev/null)"
+
+export GPG_TTY="$(tty)"
+
+[ -n "$MBSYNCRC" ] && alias mbsync="mbsync -c $MBSYNCRC" || MBSYNCRC="$HOME/.mbsyncrc"
+[ -n "$MPOPRC" ] || MPOPRC="$HOME/.config/mpop/config"
+
+lastrun="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/.mailsynclastrun"
+
+# Settings are different for MacOS (Darwin) systems.
+case "$(uname)" in
+ Darwin) notify() { osascript -e "display notification \"$2\" with title \"$1\"" ;} ;;
+ *)
+ case "$(readlink -f /sbin/init)" in
+ *systemd*|*openrc*) export DBUS_SESSION_BUS_ADDRESS=unix:path=/run/user/$(id -u)/bus ;;
+ esac
+ # remember if a display server is running since `ps` doesn't always contain a display
+ pgrepoutput="$(pgrep -ax X\(\|org\|wayland\))"
+ displays="$(echo "$pgrepoutput" | grep -wo "[0-9]*:[0-9]\+" | sort -u)"
+ [ -z "$displays" ] && [ -d /tmp/.X11-unix ] && displays=$(cd /tmp/.X11-unix && for x in X*; do echo ":${x#X}"; done)
+
+ notify() { [ -n "$pgrepoutput" ] && for x in ${displays:-:0}; do
+ export DISPLAY="$x"
+ notify-send --app-name="mutt-wizard" "$1" "$2"
+ done ;}
+ ;;
+esac
+
+# Check account for new mail. Notify if there is new content.
+syncandnotify() {
+ case "$1" in
+ imap) mbsync -q "$2" ;;
+ pop) mpop -q "$2" ;;
+ esac
+ new=$(find\
+ "$HOME/.local/share/mail/$2/"[Ii][Nn][Bb][Oo][Xx]/new/ \
+ "$HOME/.local/share/mail/$2/"[Ii][Nn][Bb][Oo][Xx]/cur/ \
+ -type f -newer "$lastrun" 2> /dev/null)
+ newcount=$(echo "$new" | sed '/^\s*$/d' | wc -l)
+ case 1 in
+ $((newcount > 5)) )
+ echo "$newcount new mail for $2."
+ [ -z "$MAILSYNC_MUTE" ] && notify "New Mail!" "📬 $newcount new mail(s) in \`$2\` account."
+ ;;
+ $((newcount > 0)) )
+ echo "$newcount new mail for $2."
+ [ -z "$MAILSYNC_MUTE" ] &&
+ for file in $new; do
+ # Extract and decode subject and sender from mail.
+ subject="$(sed -n "/^Subject:/ s|Subject: *|| p" "$file" |
+ perl -CS -MEncode -ne 'print decode("MIME-Header", $_)')"
+ from="$(sed -n "/^From:/ s|From: *|| p" "$file" |
+ perl -CS -MEncode -ne 'print decode("MIME-Header", $_)')"
+ from="${from% *}" ; from="${from%\"}" ; from="${from#\"}"
+ notify "📧$from:" "$subject"
+ done
+ ;;
+ *) echo "No new mail for $2." ;;
+esac
+}
+
+allaccounts="$(grep -hs "^\(Channel\|account\)" "$MBSYNCRC" "$MPOPRC")"
+
+# Get accounts to sync. All if no argument. Prefix with `error` if non-existent.
+IFS='
+'
+if [ -z "$1" ]; then
+ tosync="$allaccounts"
+else
+ tosync="$(for arg in "$@"; do for availacc in $allaccounts; do
+ [ "$arg" = "${availacc##* }" ] && echo "$availacc" && break
+ done || echo "error $arg"; done)"
+fi
+
+for account in $tosync; do
+ case $account in
+ Channel*) syncandnotify imap "${account##* }" & ;;
+ account*) syncandnotify pop "${account##* }" & ;;
+ error*) echo "ERROR: Account ${account##* } not found." ;;
+ esac
+done
+
+wait
+
+notmuch new --quiet
+
+#Create a touch file that indicates the time of the last run of mailsync
+touch "$lastrun"
diff --git a/bin/mw b/bin/mw
new file mode 100755
index 0000000..44086be
--- /dev/null
+++ b/bin/mw
@@ -0,0 +1,422 @@
+#!/bin/sh
+
+set -a
+
+prefix="/usr/local"
+maildir="${XDG_DATA_HOME:-$HOME/.local/share}/mail"
+muttshare="$prefix/share/mutt-wizard"
+cachedir="${XDG_CACHE_HOME:-$HOME/.cache}/mutt-wizard"
+muttrc="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/muttrc"
+accdir="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/accounts"
+msmtprc="${XDG_CONFIG_HOME:-$HOME/.config}/msmtp/config"
+msmtplog="${XDG_STATE_HOME:-$HOME/.local/state}/msmtp/msmtp.log"
+mbsyncrc="${MBSYNCRC:-$HOME/.mbsyncrc}"
+mpoprc="${XDG_CONFIG_HOME:-$HOME/.config}/mpop/config"
+mpoptemp="$muttshare/mpop-temp"
+mbsynctemp="$muttshare/mbsync-temp"
+mutttemp="$muttshare/mutt-temp"
+msmtptemp="$muttshare/msmtp-temp"
+onlinetemp="$muttshare/online-temp"
+notmuchtemp="$muttshare/notmuch-temp"
+# With the use of templates, it's impossible to use parameter substitution.
+# Therefore, some default variables that might be otherwise overwritten are set
+# here.
+iport="993"
+sport="465"
+imapssl="IMAPS"
+tlsline="tls_starttls off"
+maxmes="0"
+
+alias mbsync='mbsync -c "$mbsyncrc"'
+
+# mbsync now requires "Far/Near" rather than "Master/Slave", but Ubuntu/Debian
+# have the older version.
+if command -V apt-get >/dev/null 2>&1; then
+ master="Master"
+ slave="Slave"
+else
+ master="Far"
+ slave="Near"
+fi
+
+for x in "/etc/ssl/certs/ca-certificates.crt" \
+ "/etc/pki/tls/certs/ca-bundle.crt" "/etc/ssl/cert.pem" \
+ "/etc/ssl/ca-bundle.pem" "/etc/pki/tls/cacert.pem" \
+ "/etc/pki/ca-trust/extracted/pem/tls-ca-bundle.pem" \
+ "/usr/local/share/ca-certificates/"; do
+ [ -f "$x" ] && sslcert="$x" && break
+done || { echo "CA Certificate not found. Please install one or link it to /etc/ssl/certs/ca-certificates.crt" && exit 1; }
+
+checkbasics() {
+ command -V gpg >/dev/null 2>&1 && GPG="gpg" || GPG="gpg2"
+ PASSWORD_STORE_DIR="${PASSWORD_STORE_DIR:-$HOME/.password-store}"
+ [ -r "$PASSWORD_STORE_DIR/.gpg-id" ] || {
+ echo "First run \`pass init <yourgpgemail>\` to set up a password archive."
+ echo "(If you don't already have a GPG key pair, first run \`$GPG --full-generate-key\`.)"
+ exit 1
+ }
+}
+
+getaccounts() { accounts="$(find -L "$accdir" -type f 2>/dev/null | grep -o "\S*.muttrc" | sed "s|.*/\([0-9]-\)*||;s/\.muttrc$//" | nl)"; }
+
+list() { getaccounts && [ -n "$accounts" ] && echo "$accounts" || exit 1; }
+
+prepmsmtp() {
+ mkdir -p "${msmtprc%/*}" "${msmtplog%/*}"
+ ln -s "$msmtprc" "$HOME/.msmtprc" 2>/dev/null
+ envsubst <"$msmtptemp" >>"$msmtprc"
+}
+
+prepmbsync() {
+ mkdir -p "${mbsyncrc%/*}"
+ [ -f "$mbsyncrc" ] && echo >>"$mbsyncrc"
+ envsubst <"$mbsynctemp" >>"$mbsyncrc"
+}
+
+prepmpop() {
+ mkdir -p "${mpoprc%/*}"
+ envsubst <"$mpoptemp" >>"$mpoprc"
+}
+
+prepmutt() {
+ mkdir -p "${muttrc%/*}" "$accdir"
+ envsubst <"$mutttemp" >"$accdir/$fulladdr.muttrc"
+ [ ! -f "$muttrc" ] && echo "# vim: filetype=neomuttrc" >"$muttrc"
+ ! grep -q "^source.*mutt-wizard.muttrc" "$muttrc" && echo "source $muttshare/mutt-wizard.muttrc" >>"$muttrc"
+ ! grep "^source.*.muttrc" "$muttrc" | grep -qv "$muttshare/mutt-wizard.muttrc" && echo "source $accdir/$fulladdr.muttrc" >>"$muttrc"
+ echo "macro index,pager i$idnum '<sync-mailbox><enter-command>source $accdir/$fulladdr.muttrc<enter><change-folder>!<enter>;<check-stats>' \"switch to $fulladdr\"" >>"$muttrc"
+}
+
+getprofiles() {
+ safename="$(echo $fulladdr | sed 's/@/_/g')"
+ case "$type" in
+ online)
+ folder="imaps://$login@$imap:$iport"
+ extra="$(envsubst <"$onlinetemp")"
+ ;;
+ pop) prepmpop ;;
+ *)
+ case "$iport" in
+ 1143) imapssl=None ;;
+ 143) imapssl=STARTTLS ;;
+ esac
+ prepmbsync
+ ;;
+ esac
+ prepmsmtp
+ prepmutt
+ prepnotmuch
+}
+
+parsedomains() {
+ serverinfo="$(grep "^${fulladdr#*@}" "$muttshare/domains.csv" 2>/dev/null)"
+
+ [ -z "$serverinfo" ] && serverinfo="$(grep "$(echo "${fulladdr#*@}" | sed "s/\.[^\.]*$/\.\\\*/")" "$muttshare/domains.csv" 2>/dev/null)"
+
+ IFS=, read -r service imapsugg iportsugg smtpsugg sportsugg <<EOF
+$serverinfo
+EOF
+ imap="${imap:-$imapsugg}"
+ smtp="${smtp:-$smtpsugg}"
+ sport="${sport:-$sportsugg}"
+ iport="${iport:-$iportsugg}"
+}
+
+delete() {
+ if [ -z "${fulladdr+x}" ]; then
+ echo "Select the account you would like to delete (by number):"
+ list || exit 1
+ read -r input
+ match="^\s*$input\s\+"
+ else
+ match="\s\+$fulladdr$"
+ getaccounts
+ fi
+
+ fulladdr="$(echo "$accounts" | grep "$match" | grep -o "\S*@\S*")"
+
+ [ -z "$fulladdr" ] && echo "$fulladdr is not a valid account name." && return 1
+
+ sed -ibu "/IMAPStore $fulladdr-remote$/,/# End profile/d" "$mbsyncrc" 2>/dev/null
+ rm -f "$mbsyncrc"bu
+ rm -rf "${cachedir:?}/${fulladdr:?}" "$accdir/$fulladdr.muttrc" "$accdir/"[0-9]-"$fulladdr.muttrc"
+ sed -ibu "/\([0-9]-\)\?$fulladdr.muttrc/d" "$muttrc" 2>/dev/null
+ rm -f "$muttrc"bu
+ sed -ibu "/account $fulladdr$/,/^\(\s*$\|account\)/d" "$msmtprc" 2>/dev/null
+ rm -f "$msmtprc"bu
+ sed -ibu "/account $fulladdr$/,/^\(\s*$\|account\)/d" "$mpoprc" 2>/dev/null
+ rm -f "$mpoprc"bu
+ pass rm -f "$passprefix$fulladdr" >/dev/null 2>&1
+ [ -n "${purge+x}" ] && safename="$(echo $fulladdr | sed 's/@/_/g')" && rm -rf "${cachedir:?}/${safename:?}" "${maildir:?}/${fulladdr:?}"
+}
+
+askinfo() {
+ [ -z "$fulladdr" ] && echo "Give the full email address to add:" &&
+ read -r fulladdr
+ while ! echo "$fulladdr" | grep -qE "^.+@.+\.[A-Za-z]+$"; do
+ echo "$fulladdr is not a valid email address. Please retype the address:"
+ read -r fulladdr
+ done
+ folder="$maildir/$fulladdr"
+ getaccounts
+ echo "$accounts" | grep -q "\s$fulladdr$" 2>/dev/null &&
+ { echo "$fulladdr has already been added" && exit 1; }
+ { [ -z "$imap" ] || [ -z "$smtp" ]; } && parsedomains
+ [ -z "$imap" ] && echo "Give your email server's IMAP address (excluding the port number):" &&
+ read -r imap
+ [ -z "$smtp" ] && echo "Give your email server's SMTP address (excluding the port number):" &&
+ read -r smtp
+ case $sport in
+ 587) tlsline="# tls_starttls" ;;
+ esac
+ [ -z "$realname" ] && realname="${fulladdr%%@*}"
+ [ -z "$passprefix" ] && passprefix=""
+ hostname="${fulladdr#*@}"
+ login="${login:-$fulladdr}"
+ if [ -n "${password+x}" ] && [ ! -f "$PASSWORD_STORE_DIR/$passprefix$fulladdr.gpg" ]; then
+ insertpass
+ elif [ ! -f "$PASSWORD_STORE_DIR/$passprefix$fulladdr.gpg" ]; then
+ getpass
+ fi
+}
+
+insertpass() {
+ printf "%s" "$password" | pass insert -fe "$PASSWORD_STORE_DIR/$passprefix$fulladdr"
+}
+
+errorexit() {
+ echo "Log-on not successful."
+ case "$imap" in
+ imap.gmail.com)
+ echo "This account with $service is using Google's Gmail servers, which disable all third-party applications without an application-specific password.
+Please be sure you are using OAUTH with your Gmail account, or better yet, stop using Gmail."
+ ;;
+ imap.mail.me.com)
+ echo "This account with $service is using Apple's iCloud servers, which disable all non-Apple applications by default.
+Please be sure you either enable third-party applications, or create an app-specific password, or best of all, stop using Apple."
+ ;;
+ esac
+ exit 1
+}
+
+getpass() { while :; do
+ pass rm -f "$passprefix$fulladdr" >/dev/null 2>&1
+ pass insert -f "$passprefix$fulladdr" && break
+done; }
+
+getboxes() {
+ if [ -n "${force+x}" ]; then
+ mailboxes="$(printf "INBOX\\nDrafts\\nJunk\\nTrash\\nSent\\nArchive")"
+ else
+ info="$(curl --location-trusted -s -m 5 --user "$login:$(pass "$passprefix$fulladdr")" --url "${protocol:-imaps}://$imap:${iport:-993}")"
+ [ -z "$info" ] && errorexit
+ mailboxes="$(echo "$info" | grep -v HasChildren | sed "s/.*\" //;s/\"//g" | tr -d '\r')"
+ fi
+ [ "$type" = "pop" ] && mailboxes="INBOX"
+ for x in $(
+ sed -n "/^macro.* i[0-9] / s/\(^macro.* i\| .*\)//gp " "$muttrc" 2>/dev/null | sort -u
+ echo 0
+ ); do
+ idnum=$((idnum + 1))
+ [ "$idnum" -eq "$x" ] || break
+ done
+ toappend="mailboxes $(echo "$mailboxes" | sed "s/^/\"=/;s/$/\"/;s/'/\\\'/g" | paste -sd ' ' -)"
+}
+
+finalize() {
+ echo "$toappend" >>"$accdir/$fulladdr.muttrc"
+ [ "$type" != "online" ] && echo "$mailboxes" | xargs -I {} mkdir -p "$maildir/$fulladdr/{}/cur" "$maildir/$fulladdr/{}/tmp" "$maildir/$fulladdr/{}/new"
+ mkdir -p "$cachedir/$safename/bodies"
+ echo "$fulladdr (account #$idnum) added successfully."
+ command -V urlview >/dev/null 2>&1 && [ ! -f "$HOME/.urlview" ] && echo "COMMAND \$BROWSER" >"$HOME/.urlview"
+ return 0
+}
+
+prepnotmuch() {
+ [ -z "$NOTMUCH_CONFIG" ] && NOTMUCH_CONFIG="$HOME/.notmuch-config"
+ [ -f "$NOTMUCH_CONFIG" ] && return 0
+ envsubst <"$notmuchtemp" >"$NOTMUCH_CONFIG"
+}
+
+togglecron() {
+ cron="$(mktemp)"
+ crontab -l >"$cron"
+ if grep -q mailsync "$cron"; then
+ echo "Removing automatic mailsync..."
+ sed -ibu /mailsync/d "$cron"
+ rm -f "$cron"bu
+ else
+ echo "Adding automatic mailsync every ${cronmin:-10} minutes..."
+ echo "*/${cronmin:-10} * * * * $prefix/bin/mailsync" >>"$cron"
+ fi &&
+ crontab "$cron"
+ rm -f "$cron"
+}
+
+setact() { if [ -n "${action+x}" ] && [ "$action" != "$1" ]; then
+ echo "Running $1 with $action..."
+ echo "Incompatible options given. Only one action may be specified per run."
+ exit 1
+else
+ action="$1"
+fi; }
+
+mwinfo() {
+ cat <<EOF
+mw: mutt-wizard, auto-configure email accounts for mutt
+including downloadable mail with \`isync\`.
+
+Main actions:
+ -a your@email.com Add an email address
+ -l List email addresses configured
+ -d Remove an already added address
+ -D your@email.com Force remove account without confirmation
+ -t number Toggle automatic mailsync every <number> minutes
+ -T Toggle automatic mailsync
+ -r Reorder account numbers
+
+Options allowed with -a:
+ -u Account login name if not full address
+ -n "Real name" to be on the email account
+ -i IMAP/POP server address
+ -I IMAP/POP server port
+ -s SMTP server address
+ -S SMTP server port
+ -x Password for account (recommended to be in double quotes)
+ -p Add for a POP server instead of IMAP.
+ -P Pass Prefix (prefix of the file where password is stored)
+ -X Delete an account's local email too when deleting.
+ -o Configure address, but keep mail online.
+ -f Assume typical English mailboxes without attempting log-on.
+
+NOTE: Once at least one account is added, you can run
+\`mbsync -a\` to begin downloading mail.
+
+To change an account's password, run \`pass edit '$passprefix'your@email.com\`.
+EOF
+}
+
+reorder() {
+ tempfile="$(mktemp -u)"
+ trap 'rm -f $tempfile' HUP INT QUIT TERM PWR EXIT
+ echo "# Carefully reorder these accounts with the desired numbers in the first column.
+# DO NOT reorder rows or rename the accounts in the second column." >"$tempfile"
+ sed -n "
+ / i[0-9] / s?\(.* i\|'<sync.*/\|\.muttrc.*\)??g p
+ " "$muttrc" >>"$tempfile"
+ ${EDITOR:-vim} "$tempfile" || exit 1
+ sed -i -e 's/#.*//' -e '/^$/d' "$tempfile"
+ default="$(sort -n "$tempfile" | head -n 1)"
+ default="${default#* }"
+ sed -ibu "
+ /.* i[0-9] .*.muttrc/d
+ /^source.*accounts.*.muttrc/d
+ " "$muttrc" 2>/dev/null
+ rm -f "$muttrc"bu
+ awk -v a="$accdir" -v d="$default" ' BEGIN { print "source "a"/"d".muttrc" }
+ {
+ print "macro index,pager i"$1" '\''<sync-mailbox><enter-command>source "a"/"$2".muttrc<enter><change-folder>!<enter>;<check-stats>'\'' \"switch to "$2"\""
+ }
+ ' "$tempfile" >>"$muttrc"
+}
+
+while getopts "rfpXlhodTYD:y:i:I:s:S:u:a:n:P:x:m:t:" o; do case "${o}" in
+ l) setact list ;;
+ r) setact reorder ;;
+ d) setact delete ;;
+ D)
+ setact delete
+ fulladdr="$OPTARG"
+ ;;
+ y)
+ setact sync
+ fulladdr="$OPTARG"
+ ;;
+ Y) setact sync ;;
+ a)
+ setact add
+ fulladdr="$OPTARG"
+ ;;
+ i)
+ setact add
+ imap="$OPTARG"
+ ;;
+ I)
+ setact add
+ iport="$OPTARG"
+ ;;
+ s)
+ setact add
+ smtp="$OPTARG"
+ ;;
+ S)
+ setact add
+ sport="$OPTARG"
+ ;;
+ u)
+ setact add
+ login="$OPTARG"
+ ;;
+ n)
+ setact add
+ realname="$OPTARG"
+ ;;
+ P)
+ setact add
+ passprefix="$OPTARG"
+ ;;
+ m)
+ setact add
+ maxmes="$OPTARG"
+ ;;
+ o)
+ setact add
+ type="online"
+ ;;
+ p)
+ setact add
+ type="pop"
+ protocol="pop3s"
+ iport="${iport:-995}"
+ ;;
+ f)
+ setact add
+ force=True
+ ;;
+ x)
+ setact add
+ password="$OPTARG"
+ ;;
+ X)
+ setact delete
+ purge=True
+ ;;
+ t)
+ setact toggle
+ cronmin="$OPTARG"
+ ;;
+ T) setact toggle ;;
+ h) setact info ;;
+ \?)
+ echo "See \`$(basename $0) -h\` for possible options and help."
+ exit 1
+ ;;
+ esac done
+
+[ -z "$action" ] && action="info"
+
+case "$action" in
+list) list ;;
+add) checkbasics && askinfo && getboxes && getprofiles && finalize ;;
+delete) delete ;;
+sync)
+ echo "\`mw -y\` and \`mw -Y\` are now deprecated and will be removed in a future update. Please switch to using \`mailsync\`."
+ mailsync $fulladdr
+ ;;
+toggle) togglecron ;;
+reorder) reorder ;;
+info)
+ mwinfo
+ exit 1
+ ;;
+esac