init

2 files changed, 534 insertions, 0 deletions

diff --git a/bin/mailsync b/bin/mailsync
new file mode 100755
index 0000000..cbd36ff
--- /dev/null
+++ b/bin/mailsync
@@ -0,0 +1,112 @@
+#!/bin/sh
+
+# - Syncs mail for all accounts, or a single account given as an argument.
+# - Displays a notification showing the number of new mails.
+# - Displays a notification for each new mail with its subject displayed.
+# - Runs notmuch to index new mail.
+# - This script can be set up as a cron job for automated mail syncing.
+
+# There are many arbitrary and ugly features in this script because it is
+# inherently difficult to pass environmental variables to cronjobs and other
+# issues. It also should at least be compatible with Linux (and maybe BSD) with
+# Xorg and MacOS as well.
+
+# Run only if not already running in other instance
+pgrep mbsync >/dev/null && { echo "mbsync is already running."; exit ;}
+
+# First, we have to get the right variables for the mbsync file, the pass
+# archive, notmuch and the GPG home.  This is done by searching common profile
+# files for variable assignments. This is ugly, but there are few options that
+# will work on the maximum number of machines.
+eval "$(grep -h -- \
+	"^\s*\(export \)\?\(MBSYNCRC\|MPOPRC\|PASSWORD_STORE_DIR\|PASSWORD_STORE_GPG_OPTS\|NOTMUCH_CONFIG\|GNUPGHOME\|MAILSYNC_MUTE\|XDG_CONFIG_HOME\|XDG_DATA_HOME\)=" \
+	"$HOME/.profile" "$HOME/.bash_profile" "$HOME/.zprofile"  "$HOME/.config/zsh/.zprofile" "$HOME/.zshenv" \
+	"$HOME/.config/zsh/.zshenv" "$HOME/.bashrc" "$HOME/.zshrc" "$HOME/.config/zsh/.zshrc" \
+	"$HOME/.pam_environment" 2>/dev/null)"
+
+export GPG_TTY="$(tty)"
+
+[ -n "$MBSYNCRC" ] && alias mbsync="mbsync -c $MBSYNCRC" || MBSYNCRC="$HOME/.mbsyncrc"
+[ -n "$MPOPRC" ] || MPOPRC="$HOME/.config/mpop/config"
+
+lastrun="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/.mailsynclastrun"
+
+# Settings are different for MacOS (Darwin) systems.
+case "$(uname)" in
+	Darwin) notify() { osascript -e "display notification \"$2\" with title \"$1\"" ;} ;;
+	*)
+	case "$(readlink -f /sbin/init)" in
+		*systemd*|*openrc*) export DBUS_SESSION_BUS_ADDRESS=unix:path=/run/user/$(id -u)/bus ;;
+	esac
+	# remember if a display server is running since `ps` doesn't always contain a display
+	pgrepoutput="$(pgrep -ax X\(\|org\|wayland\))"
+	displays="$(echo "$pgrepoutput" | grep -wo "[0-9]*:[0-9]\+" | sort -u)"
+	[ -z "$displays" ] && [ -d /tmp/.X11-unix ] && displays=$(cd /tmp/.X11-unix && for x in X*; do echo ":${x#X}"; done)
+
+	notify() { [ -n "$pgrepoutput" ] && for x in ${displays:-:0}; do
+			export DISPLAY="$x"
+			notify-send --app-name="mutt-wizard" "$1" "$2"
+		done ;}
+	;;
+esac
+
+# Check account for new mail. Notify if there is new content.
+syncandnotify() {
+	case "$1" in
+		imap) mbsync -q "$2" ;;
+		pop) mpop -q "$2" ;;
+	esac
+	new=$(find\
+		"$HOME/.local/share/mail/$2/"[Ii][Nn][Bb][Oo][Xx]/new/ \
+		"$HOME/.local/share/mail/$2/"[Ii][Nn][Bb][Oo][Xx]/cur/ \
+		-type f -newer "$lastrun" 2> /dev/null)
+	newcount=$(echo "$new" | sed '/^\s*$/d' | wc -l)
+	case 1 in
+		$((newcount > 5)) )
+			echo "$newcount new mail for $2."
+			[ -z "$MAILSYNC_MUTE" ] && notify "New Mail!" "📬 $newcount new mail(s) in \`$2\` account."
+			;;
+		$((newcount > 0)) )
+			echo "$newcount new mail for $2."
+			[ -z "$MAILSYNC_MUTE" ] &&
+			for file in $new; do
+		    		# Extract and decode subject and sender from mail.
+				subject="$(sed -n "/^Subject:/ s|Subject: *|| p" "$file" |
+					perl -CS -MEncode -ne 'print decode("MIME-Header", $_)')"
+				from="$(sed -n "/^From:/ s|From: *|| p" "$file" |
+					perl -CS -MEncode -ne 'print decode("MIME-Header", $_)')"
+				from="${from% *}" ; from="${from%\"}" ; from="${from#\"}"
+				notify "📧$from:" "$subject"
+			done
+			;;
+		*) echo "No new mail for $2." ;;
+esac
+}
+
+allaccounts="$(grep -hs "^\(Channel\|account\)" "$MBSYNCRC" "$MPOPRC")"
+
+# Get accounts to sync. All if no argument. Prefix with `error` if non-existent.
+IFS='
+'
+if [ -z "$1" ]; then
+	tosync="$allaccounts"
+else
+	tosync="$(for arg in "$@"; do for availacc in $allaccounts; do
+		[ "$arg" = "${availacc##* }" ] && echo "$availacc" && break
+	done || echo "error $arg"; done)"
+fi
+
+for account in $tosync; do
+	case $account in
+		Channel*) syncandnotify imap "${account##* }" & ;;
+		account*) syncandnotify pop "${account##* }" & ;;
+		error*) echo "ERROR: Account ${account##* } not found." ;;
+	esac
+done
+
+wait
+
+notmuch new --quiet
+
+#Create a touch file that indicates the time of the last run of mailsync
+touch "$lastrun"
diff --git a/bin/mw b/bin/mw
new file mode 100755
index 0000000..44086be
--- /dev/null
+++ b/bin/mw
@@ -0,0 +1,422 @@
+#!/bin/sh
+
+set -a
+
+prefix="/usr/local"
+maildir="${XDG_DATA_HOME:-$HOME/.local/share}/mail"
+muttshare="$prefix/share/mutt-wizard"
+cachedir="${XDG_CACHE_HOME:-$HOME/.cache}/mutt-wizard"
+muttrc="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/muttrc"
+accdir="${XDG_CONFIG_HOME:-$HOME/.config}/mutt/accounts"
+msmtprc="${XDG_CONFIG_HOME:-$HOME/.config}/msmtp/config"
+msmtplog="${XDG_STATE_HOME:-$HOME/.local/state}/msmtp/msmtp.log"
+mbsyncrc="${MBSYNCRC:-$HOME/.mbsyncrc}"
+mpoprc="${XDG_CONFIG_HOME:-$HOME/.config}/mpop/config"
+mpoptemp="$muttshare/mpop-temp"
+mbsynctemp="$muttshare/mbsync-temp"
+mutttemp="$muttshare/mutt-temp"
+msmtptemp="$muttshare/msmtp-temp"
+onlinetemp="$muttshare/online-temp"
+notmuchtemp="$muttshare/notmuch-temp"
+# With the use of templates, it's impossible to use parameter substitution.
+# Therefore, some default variables that might be otherwise overwritten are set
+# here.
+iport="993"
+sport="465"
+imapssl="IMAPS"
+tlsline="tls_starttls off"
+maxmes="0"
+
+alias mbsync='mbsync -c "$mbsyncrc"'
+
+# mbsync now requires "Far/Near" rather than "Master/Slave", but Ubuntu/Debian
+# have the older version.
+if command -V apt-get >/dev/null 2>&1; then
+	master="Master"
+	slave="Slave"
+else
+	master="Far"
+	slave="Near"
+fi
+
+for x in "/etc/ssl/certs/ca-certificates.crt" \
+	"/etc/pki/tls/certs/ca-bundle.crt" "/etc/ssl/cert.pem" \
+	"/etc/ssl/ca-bundle.pem" "/etc/pki/tls/cacert.pem" \
+	"/etc/pki/ca-trust/extracted/pem/tls-ca-bundle.pem" \
+	"/usr/local/share/ca-certificates/"; do
+	[ -f "$x" ] && sslcert="$x" && break
+done || { echo "CA Certificate not found. Please install one or link it to /etc/ssl/certs/ca-certificates.crt" && exit 1; }
+
+checkbasics() {
+	command -V gpg >/dev/null 2>&1 && GPG="gpg" || GPG="gpg2"
+	PASSWORD_STORE_DIR="${PASSWORD_STORE_DIR:-$HOME/.password-store}"
+	[ -r "$PASSWORD_STORE_DIR/.gpg-id" ] || {
+		echo "First run \`pass init <yourgpgemail>\` to set up a password archive."
+		echo "(If you don't already have a GPG key pair, first run \`$GPG --full-generate-key\`.)"
+		exit 1
+	}
+}
+
+getaccounts() { accounts="$(find -L "$accdir" -type f 2>/dev/null | grep -o "\S*.muttrc" | sed "s|.*/\([0-9]-\)*||;s/\.muttrc$//" | nl)"; }
+
+list() { getaccounts && [ -n "$accounts" ] && echo "$accounts" || exit 1; }
+
+prepmsmtp() {
+	mkdir -p "${msmtprc%/*}" "${msmtplog%/*}"
+	ln -s "$msmtprc" "$HOME/.msmtprc" 2>/dev/null
+	envsubst <"$msmtptemp" >>"$msmtprc"
+}
+
+prepmbsync() {
+	mkdir -p "${mbsyncrc%/*}"
+	[ -f "$mbsyncrc" ] && echo >>"$mbsyncrc"
+	envsubst <"$mbsynctemp" >>"$mbsyncrc"
+}
+
+prepmpop() {
+	mkdir -p "${mpoprc%/*}"
+	envsubst <"$mpoptemp" >>"$mpoprc"
+}
+
+prepmutt() {
+	mkdir -p "${muttrc%/*}" "$accdir"
+	envsubst <"$mutttemp" >"$accdir/$fulladdr.muttrc"
+	[ ! -f "$muttrc" ] && echo "# vim: filetype=neomuttrc" >"$muttrc"
+	! grep -q "^source.*mutt-wizard.muttrc" "$muttrc" && echo "source $muttshare/mutt-wizard.muttrc" >>"$muttrc"
+	! grep "^source.*.muttrc" "$muttrc" | grep -qv "$muttshare/mutt-wizard.muttrc" && echo "source $accdir/$fulladdr.muttrc" >>"$muttrc"
+	echo "macro index,pager i$idnum '<sync-mailbox><enter-command>source $accdir/$fulladdr.muttrc<enter><change-folder>!<enter>;<check-stats>' \"switch to $fulladdr\"" >>"$muttrc"
+}
+
+getprofiles() {
+	safename="$(echo $fulladdr | sed 's/@/_/g')"
+	case "$type" in
+	online)
+		folder="imaps://$login@$imap:$iport"
+		extra="$(envsubst <"$onlinetemp")"
+		;;
+	pop) prepmpop ;;
+	*)
+		case "$iport" in
+		1143) imapssl=None ;;
+		143) imapssl=STARTTLS ;;
+		esac
+		prepmbsync
+		;;
+	esac
+	prepmsmtp
+	prepmutt
+	prepnotmuch
+}
+
+parsedomains() {
+	serverinfo="$(grep "^${fulladdr#*@}" "$muttshare/domains.csv" 2>/dev/null)"
+
+	[ -z "$serverinfo" ] && serverinfo="$(grep "$(echo "${fulladdr#*@}" | sed "s/\.[^\.]*$/\.\\\*/")" "$muttshare/domains.csv" 2>/dev/null)"
+
+	IFS=, read -r service imapsugg iportsugg smtpsugg sportsugg <<EOF
+$serverinfo
+EOF
+	imap="${imap:-$imapsugg}"
+	smtp="${smtp:-$smtpsugg}"
+	sport="${sport:-$sportsugg}"
+	iport="${iport:-$iportsugg}"
+}
+
+delete() {
+	if [ -z "${fulladdr+x}" ]; then
+		echo "Select the account you would like to delete (by number):"
+		list || exit 1
+		read -r input
+		match="^\s*$input\s\+"
+	else
+		match="\s\+$fulladdr$"
+		getaccounts
+	fi
+
+	fulladdr="$(echo "$accounts" | grep "$match" | grep -o "\S*@\S*")"
+
+	[ -z "$fulladdr" ] && echo "$fulladdr is not a valid account name." && return 1
+
+	sed -ibu "/IMAPStore $fulladdr-remote$/,/# End profile/d" "$mbsyncrc" 2>/dev/null
+	rm -f "$mbsyncrc"bu
+	rm -rf "${cachedir:?}/${fulladdr:?}" "$accdir/$fulladdr.muttrc" "$accdir/"[0-9]-"$fulladdr.muttrc"
+	sed -ibu "/\([0-9]-\)\?$fulladdr.muttrc/d" "$muttrc" 2>/dev/null
+	rm -f "$muttrc"bu
+	sed -ibu "/account $fulladdr$/,/^\(\s*$\|account\)/d" "$msmtprc" 2>/dev/null
+	rm -f "$msmtprc"bu
+	sed -ibu "/account $fulladdr$/,/^\(\s*$\|account\)/d" "$mpoprc" 2>/dev/null
+	rm -f "$mpoprc"bu
+	pass rm -f "$passprefix$fulladdr" >/dev/null 2>&1
+	[ -n "${purge+x}" ] && safename="$(echo $fulladdr | sed 's/@/_/g')" && rm -rf "${cachedir:?}/${safename:?}" "${maildir:?}/${fulladdr:?}"
+}
+
+askinfo() {
+	[ -z "$fulladdr" ] && echo "Give the full email address to add:" &&
+		read -r fulladdr
+	while ! echo "$fulladdr" | grep -qE "^.+@.+\.[A-Za-z]+$"; do
+		echo "$fulladdr is not a valid email address. Please retype the address:"
+		read -r fulladdr
+	done
+	folder="$maildir/$fulladdr"
+	getaccounts
+	echo "$accounts" | grep -q "\s$fulladdr$" 2>/dev/null &&
+		{ echo "$fulladdr has already been added" && exit 1; }
+	{ [ -z "$imap" ] || [ -z "$smtp" ]; } && parsedomains
+	[ -z "$imap" ] && echo "Give your email server's IMAP address (excluding the port number):" &&
+		read -r imap
+	[ -z "$smtp" ] && echo "Give your email server's SMTP address (excluding the port number):" &&
+		read -r smtp
+	case $sport in
+	587) tlsline="# tls_starttls" ;;
+	esac
+	[ -z "$realname" ] && realname="${fulladdr%%@*}"
+	[ -z "$passprefix" ] && passprefix=""
+	hostname="${fulladdr#*@}"
+	login="${login:-$fulladdr}"
+	if [ -n "${password+x}" ] && [ ! -f "$PASSWORD_STORE_DIR/$passprefix$fulladdr.gpg" ]; then
+		insertpass
+	elif [ ! -f "$PASSWORD_STORE_DIR/$passprefix$fulladdr.gpg" ]; then
+		getpass
+    fi
+}
+
+insertpass() {
+	printf "%s" "$password" | pass insert -fe "$PASSWORD_STORE_DIR/$passprefix$fulladdr"
+}
+
+errorexit() {
+	echo "Log-on not successful."
+	case "$imap" in
+	imap.gmail.com)
+		echo "This account with $service is using Google's Gmail servers, which disable all third-party applications without an application-specific password.
+Please be sure you are using OAUTH with your Gmail account, or better yet, stop using Gmail."
+		;;
+	imap.mail.me.com)
+		echo "This account with $service is using Apple's iCloud servers, which disable all non-Apple applications by default.
+Please be sure you either enable third-party applications, or create an app-specific password, or best of all, stop using Apple."
+		;;
+	esac
+	exit 1
+}
+
+getpass() { while :; do
+	pass rm -f "$passprefix$fulladdr" >/dev/null 2>&1
+	pass insert -f "$passprefix$fulladdr" && break
+done; }
+
+getboxes() {
+	if [ -n "${force+x}" ]; then
+		mailboxes="$(printf "INBOX\\nDrafts\\nJunk\\nTrash\\nSent\\nArchive")"
+	else
+		info="$(curl --location-trusted -s -m 5 --user "$login:$(pass "$passprefix$fulladdr")" --url "${protocol:-imaps}://$imap:${iport:-993}")"
+		[ -z "$info" ] && errorexit
+		mailboxes="$(echo "$info" | grep -v HasChildren | sed "s/.*\" //;s/\"//g" | tr -d '\r')"
+	fi
+	[ "$type" = "pop" ] && mailboxes="INBOX"
+	for x in $(
+		sed -n "/^macro.* i[0-9] / s/\(^macro.* i\| .*\)//gp " "$muttrc" 2>/dev/null | sort -u
+		echo 0
+	); do
+		idnum=$((idnum + 1))
+		[ "$idnum" -eq "$x" ] || break
+	done
+	toappend="mailboxes $(echo "$mailboxes" | sed "s/^/\"=/;s/$/\"/;s/'/\\\'/g" | paste -sd ' ' -)"
+}
+
+finalize() {
+	echo "$toappend" >>"$accdir/$fulladdr.muttrc"
+	[ "$type" != "online" ] && echo "$mailboxes" | xargs -I {} mkdir -p "$maildir/$fulladdr/{}/cur" "$maildir/$fulladdr/{}/tmp" "$maildir/$fulladdr/{}/new"
+	mkdir -p "$cachedir/$safename/bodies"
+	echo "$fulladdr (account #$idnum) added successfully."
+	command -V urlview >/dev/null 2>&1 && [ ! -f "$HOME/.urlview" ] && echo "COMMAND \$BROWSER" >"$HOME/.urlview"
+	return 0
+}
+
+prepnotmuch() {
+	[ -z "$NOTMUCH_CONFIG" ] && NOTMUCH_CONFIG="$HOME/.notmuch-config"
+	[ -f "$NOTMUCH_CONFIG" ] && return 0
+	envsubst <"$notmuchtemp" >"$NOTMUCH_CONFIG"
+}
+
+togglecron() {
+	cron="$(mktemp)"
+	crontab -l >"$cron"
+	if grep -q mailsync "$cron"; then
+		echo "Removing automatic mailsync..."
+		sed -ibu /mailsync/d "$cron"
+		rm -f "$cron"bu
+	else
+		echo "Adding automatic mailsync every ${cronmin:-10} minutes..."
+		echo "*/${cronmin:-10} * * * * $prefix/bin/mailsync" >>"$cron"
+	fi &&
+		crontab "$cron"
+	rm -f "$cron"
+}
+
+setact() { if [ -n "${action+x}" ] && [ "$action" != "$1" ]; then
+	echo "Running $1 with $action..."
+	echo "Incompatible options given. Only one action may be specified per run."
+	exit 1
+else
+	action="$1"
+fi; }
+
+mwinfo() {
+	cat <<EOF
+mw: mutt-wizard, auto-configure email accounts for mutt
+including downloadable mail with \`isync\`.
+
+Main actions:
+  -a your@email.com	Add an email address
+  -l			List email addresses configured
+  -d			Remove an already added address
+  -D your@email.com	Force remove account without confirmation
+  -t number		Toggle automatic mailsync every <number> minutes
+  -T			Toggle automatic mailsync
+  -r			Reorder account numbers
+
+Options allowed with -a:
+  -u	Account login name if not full address
+  -n	"Real name" to be on the email account
+  -i	IMAP/POP server address
+  -I	IMAP/POP server port
+  -s	SMTP server address
+  -S	SMTP server port
+  -x	Password for account (recommended to be in double quotes)
+  -p	Add for a POP server instead of IMAP.
+  -P	Pass Prefix (prefix of the file where password is stored)
+  -X	Delete an account's local email too when deleting.
+  -o	Configure address, but keep mail online.
+  -f	Assume typical English mailboxes without attempting log-on.
+
+NOTE: Once at least one account is added, you can run
+\`mbsync -a\` to begin downloading mail.
+
+To change an account's password, run \`pass edit '$passprefix'your@email.com\`.
+EOF
+}
+
+reorder() {
+	tempfile="$(mktemp -u)"
+	trap 'rm -f $tempfile' HUP INT QUIT TERM PWR EXIT
+	echo "# Carefully reorder these accounts with the desired numbers in the first column.
+# DO NOT reorder rows or rename the accounts in the second column." >"$tempfile"
+	sed -n "
+	/ i[0-9] / s?\(.* i\|'<sync.*/\|\.muttrc.*\)??g p
+	" "$muttrc" >>"$tempfile"
+	${EDITOR:-vim} "$tempfile" || exit 1
+	sed -i -e 's/#.*//' -e '/^$/d' "$tempfile"
+	default="$(sort -n "$tempfile" | head -n 1)"
+	default="${default#* }"
+	sed -ibu "
+  /.* i[0-9] .*.muttrc/d
+  /^source.*accounts.*.muttrc/d
+  " "$muttrc" 2>/dev/null
+	rm -f "$muttrc"bu
+	awk -v a="$accdir" -v d="$default" ' BEGIN { print "source "a"/"d".muttrc" }
+		{
+		print "macro index,pager i"$1" '\''<sync-mailbox><enter-command>source "a"/"$2".muttrc<enter><change-folder>!<enter>;<check-stats>'\'' \"switch to "$2"\""
+		}
+	' "$tempfile" >>"$muttrc"
+}
+
+while getopts "rfpXlhodTYD:y:i:I:s:S:u:a:n:P:x:m:t:" o; do case "${o}" in
+	l) setact list ;;
+	r) setact reorder ;;
+	d) setact delete ;;
+	D)
+		setact delete
+		fulladdr="$OPTARG"
+		;;
+	y)
+		setact sync
+		fulladdr="$OPTARG"
+		;;
+	Y) setact sync ;;
+	a)
+		setact add
+		fulladdr="$OPTARG"
+		;;
+	i)
+		setact add
+		imap="$OPTARG"
+		;;
+	I)
+		setact add
+		iport="$OPTARG"
+		;;
+	s)
+		setact add
+		smtp="$OPTARG"
+		;;
+	S)
+		setact add
+		sport="$OPTARG"
+		;;
+	u)
+		setact add
+		login="$OPTARG"
+		;;
+	n)
+		setact add
+		realname="$OPTARG"
+		;;
+	P)
+		setact add
+		passprefix="$OPTARG"
+		;;
+	m)
+		setact add
+		maxmes="$OPTARG"
+		;;
+	o)
+		setact add
+		type="online"
+		;;
+	p)
+		setact add
+		type="pop"
+		protocol="pop3s"
+		iport="${iport:-995}"
+		;;
+	f)
+		setact add
+		force=True
+		;;
+	x)
+		setact add
+		password="$OPTARG"
+		;;
+	X)
+		setact delete
+		purge=True
+		;;
+	t)
+		setact toggle
+		cronmin="$OPTARG"
+		;;
+	T) setact toggle ;;
+	h) setact info ;;
+	\?)
+		echo "See \`$(basename $0) -h\` for possible options and help."
+		exit 1
+		;;
+	esac done
+
+[ -z "$action" ] && action="info"
+
+case "$action" in
+list) list ;;
+add) checkbasics && askinfo && getboxes && getprofiles && finalize ;;
+delete) delete ;;
+sync)
+	echo "\`mw -y\` and \`mw -Y\` are now deprecated and will be removed in a future update. Please switch to using \`mailsync\`."
+	mailsync $fulladdr
+	;;
+toggle) togglecron ;;
+reorder) reorder ;;
+info)
+	mwinfo
+	exit 1
+	;;
+esac